C13H18FN3O3 — CID 124755480
(4R)-4-[(5-fluoro-4-methoxypyrimidin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one (PubChem CID 124755480) has the molecular formula C13H18FN3O3 and a molecular weight of 283.30 g/mol. Its IUPAC name is (4R)-4-[(5-fluoro-4-methoxypyrimidin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one.
| Compound Name | (4R)-4-[(5-fluoro-4-methoxypyrimidin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124755480 |
| Molecular Formula | C13H18FN3O3 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | (4R)-4-[(5-fluoro-4-methoxypyrimidin-2-yl)methyl]-1-(2-methoxyethyl)pyrrolidin-2-one |
| SMILES | COCCN1C[C@H](Cc2ncc(F)c(OC)n2)CC1=O |
| InChI | InChI=1S/C13H18FN3O3/c1-19-4-3-17-8-9(6-12(17)18)5-11-15-7-10(14)13(16-11)20-2/h7,9H,3-6,8H2,1-2H3/t9-/m1/s1 |
| InChIKey | QOGYTOBSDWJSQY-SECBINFHSA-N |
| XLogP | 0.66 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |