C18H22N4O — CID 124756382
N-methyl-1-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)methanamine (PubChem CID 124756382) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is N-methyl-1-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)methanamine.
| Compound Name | N-methyl-1-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)methanamine |
|---|---|
| PubChem CID | 124756382 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | N-methyl-1-[(5R)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]-N-(1,4,5,6-tetrahydrocyclopenta[d]pyrazol-3-ylmethyl)methanamine |
| SMILES | CN(Cc1n[nH]c2c1CCC2)C[C@H]1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C18H22N4O/c1-22(12-18-15-8-5-9-16(15)19-20-18)11-14-10-17(21-23-14)13-6-3-2-4-7-13/h2-4,6-7,14H,5,8-12H2,1H3,(H,19,20)/t14-/m1/s1 |
| InChIKey | SOAWCNJKVLZVAF-CQSZACIVSA-N |
| XLogP | 2.52 |
| TPSA | 53.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |