C18H27FN2O2 — CID 124757480
(2R)-2-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 124757480) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is (2R)-2-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2R)-2-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 124757480 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (2R)-2-[(4-fluorophenyl)methyl-(3-methoxypropyl)amino]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | COCCCN(Cc1ccc(F)cc1)[C@H](C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C18H27FN2O2/c1-15(18(22)20-10-3-4-11-20)21(12-5-13-23-2)14-16-6-8-17(19)9-7-16/h6-9,15H,3-5,10-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | WLHSUZTWFVSZSA-OAHLLOKOSA-N |
| XLogP | 2.68 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|