C29H28N2O2 — CID 124762880
(4aR,5aS,8aR,13aR,15E,15aR,15bR)-15-[(4-methylphenyl)methylidene]-2,4a,5,5a,7,8,13a,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one (PubChem CID 124762880) has the molecular formula C29H28N2O2 and a molecular weight of 436.56 g/mol. Its IUPAC name is (4aR,5aS,8aR,13aR,15E,15aR,15bR)-15-[(4-methylphenyl)methylidene]-2,4a,5,5a,7,8,13a,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one.
| Compound Name | (4aR,5aS,8aR,13aR,15E,15aR,15bR)-15-[(4-methylphenyl)methylidene]-2,4a,5,5a,7,8,13a,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
|---|---|
| PubChem CID | 124762880 |
| Molecular Formula | C29H28N2O2 |
| Molecular Weight | 436.56 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (4aR,5aS,8aR,13aR,15E,15aR,15bR)-15-[(4-methylphenyl)methylidene]-2,4a,5,5a,7,8,13a,15a,15b,16-decahydro4,6-methanoindolo[3,2,1-ij]oxepino[2,3,4-de]pyrrolo[2,3-h]quinolin-14-one |
| SMILES | Cc1ccc(/C=C2/C(=O)N3c4ccccc4[C@]45CCN6CC7=CCO[C@@H]2[C@H]([C@H]7C[C@H]64)[C@@H]35)cc1 |
| InChI | InChI=1S/C29H28N2O2/c1-17-6-8-18(9-7-17)14-21-26-25-20-15-24-29(11-12-30(24)16-19(20)10-13-33-26)22-4-2-3-5-23(22)31(27(25)29)28(21)32/h2-10,14,20,24-27H,11-13,15-16H2,1H3/b21-14+/t20-,24-,25-,26-,27+,29+/m0/s1 |
| InChIKey | GFIRKZRNWVSINQ-VDSQZRBCSA-N |
| XLogP | 4.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|