C21H26N4O5 — CID 124764016
(1R,2S,5R,6S,7R)-2-N-tert-butyl-3-cyclopropyl-6-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124764016) has the molecular formula C21H26N4O5 and a molecular weight of 414.46 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R)-2-N-tert-butyl-3-cyclopropyl-6-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7R)-2-N-tert-butyl-3-cyclopropyl-6-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124764016 |
| Molecular Formula | C21H26N4O5 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | (1R,2S,5R,6S,7R)-2-N-tert-butyl-3-cyclopropyl-6-N-(5-methyl-1,2-oxazol-3-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cc(NC(=O)[C@H]2[C@H]3C(=O)N(C4CC4)[C@H](C(=O)NC(C)(C)C)[C@@]34C=C[C@H]2O4)no1 |
| InChI | InChI=1S/C21H26N4O5/c1-10-9-13(24-30-10)22-17(26)14-12-7-8-21(29-12)15(14)19(28)25(11-5-6-11)16(21)18(27)23-20(2,3)4/h7-9,11-12,14-16H,5-6H2,1-4H3,(H,23,27)(H,22,24,26)/t12-,14-,15+,16-,21-/m1/s1 |
| InChIKey | PAKNSOKCSUMLET-RFYZERNVSA-N |
| XLogP | 1.15 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|