C25H28N4O5 — CID 98111520
(1R,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98111520) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (1R,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98111520 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (1R,2R,5S,6R,7R)-2-N-tert-butyl-6-N-(5-methyl-1,2-oxazol-3-yl)-3-(2-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cc(NC(=O)[C@H]2[C@H]3C=C[C@]4(O3)[C@H](C(=O)NC(C)(C)C)N(c3ccccc3C)C(=O)[C@@H]24)no1 |
| InChI | InChI=1S/C25H28N4O5/c1-13-8-6-7-9-15(13)29-20(22(31)27-24(3,4)5)25-11-10-16(33-25)18(19(25)23(29)32)21(30)26-17-12-14(2)34-28-17/h6-12,16,18-20H,1-5H3,(H,27,31)(H,26,28,30)/t16-,18+,19-,20+,25-/m1/s1 |
| InChIKey | JUJDCRSGAUEBHO-OYFHFJOTSA-N |
| XLogP | 2.50 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|