C21H26N2O3S2 — CID 124764806
N-[(3aR,6aS)-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide (PubChem CID 124764806) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-[(3aR,6aS)-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[(3aR,6aS)-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 124764806 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-[(3aR,6aS)-3-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(CC(=O)/N=C2\S[C@@H]3CS(=O)(=O)C[C@H]3N2[C@H]2C[C@H]3CC[C@H]2C3)c1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-13-3-2-4-14(7-13)10-20(24)22-21-23(17-9-15-5-6-16(17)8-15)18-11-28(25,26)12-19(18)27-21/h2-4,7,15-19H,5-6,8-12H2,1H3/b22-21-/t15-,16-,17-,18+,19+/m0/s1 |
| InChIKey | KILWCWIZDXQLCF-NHNCMVKQSA-N |
| XLogP | 2.82 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|