C26H30ClN3O6S2 — CID 124764847
tert-butyl N-[(2S)-1-[[(3aR,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 124764847) has the molecular formula C26H30ClN3O6S2 and a molecular weight of 580.13 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3aR,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3aR,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 124764847 |
| Molecular Formula | C26H30ClN3O6S2 |
| Molecular Weight | 580.13 g/mol |
| Exact Mass | 579.13 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3aR,6aS)-3-(5-chloro-2-methoxyphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | COc1ccc(Cl)cc1N1/C(=N/C(=O)[C@H](Cc2ccccc2)NC(=O)OC(C)(C)C)S[C@@H]2CS(=O)(=O)C[C@H]21 |
| InChI | InChI=1S/C26H30ClN3O6S2/c1-26(2,3)36-25(32)28-18(12-16-8-6-5-7-9-16)23(31)29-24-30(19-13-17(27)10-11-21(19)35-4)20-14-38(33,34)15-22(20)37-24/h5-11,13,18,20,22H,12,14-15H2,1-4H3,(H,28,32)/b29-24-/t18-,20+,22+/m0/s1 |
| InChIKey | LKCGTIWRCYNPNR-PVXBNXRRSA-N |
| XLogP | 4.09 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.13 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|