C25H27Cl2N3O5S2 — CID 98192169
tert-butyl N-[(2S)-1-[[(3aS,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 98192169) has the molecular formula C25H27Cl2N3O5S2 and a molecular weight of 584.55 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3aS,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3aS,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 98192169 |
| Molecular Formula | C25H27Cl2N3O5S2 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 583.08 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3aS,6aR)-3-(2,5-dichlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C25H27Cl2N3O5S2/c1-25(2,3)35-24(32)28-18(11-15-7-5-4-6-8-15)22(31)29-23-30(19-12-16(26)9-10-17(19)27)20-13-37(33,34)14-21(20)36-23/h4-10,12,18,20-21H,11,13-14H2,1-3H3,(H,28,32)/b29-23-/t18-,20-,21-/m0/s1 |
| InChIKey | WFOYTGZTVWRXRJ-ZWNFDDIPSA-N |
| XLogP | 4.73 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|