C21H20N6O4 — CID 124765599
2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 124765599) has the molecular formula C21H20N6O4 and a molecular weight of 420.43 g/mol. Its IUPAC name is 2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 124765599 |
| Molecular Formula | C21H20N6O4 |
| Molecular Weight | 420.43 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 2-[(1S,2R,6R,7S,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | COc1ccc(NC(=O)CN2C(=O)[C@@H]3[C@H]4C=C[C@@H]([C@@H]5C[C@H]45)[C@H]3C2=O)cc1-n1cnnn1 |
| InChI | InChI=1S/C21H20N6O4/c1-31-16-5-2-10(6-15(16)27-9-22-24-25-27)23-17(28)8-26-20(29)18-11-3-4-12(14-7-13(11)14)19(18)21(26)30/h2-6,9,11-14,18-19H,7-8H2,1H3,(H,23,28)/t11-,12-,13-,14+,18+,19+/m0/s1 |
| InChIKey | INWLFMOBACCNID-DPXVYKJRSA-N |
| XLogP | 0.66 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.43 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|