C17H22N6O2 — CID 119798058
2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide (PubChem CID 119798058) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide.
| Compound Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 119798058 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | 2-(8-azabicyclo[3.2.1]octan-3-yl)-N-[4-methoxy-3-(tetrazol-1-yl)phenyl]acetamide |
| SMILES | COc1ccc(NC(=O)CC2CC3CCC(C2)N3)cc1-n1cnnn1 |
| InChI | InChI=1S/C17H22N6O2/c1-25-16-5-4-14(9-15(16)23-10-18-21-22-23)20-17(24)8-11-6-12-2-3-13(7-11)19-12/h4-5,9-13,19H,2-3,6-8H2,1H3,(H,20,24) |
| InChIKey | VTCDRIRKKDZXPV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |