C26H26FN3O5 — CID 124765839
(1S,2R,5R,6S,7R)-2-N-benzyl-6-N-(2-fluorophenyl)-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124765839) has the molecular formula C26H26FN3O5 and a molecular weight of 479.51 g/mol. Its IUPAC name is (1S,2R,5R,6S,7R)-2-N-benzyl-6-N-(2-fluorophenyl)-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6S,7R)-2-N-benzyl-6-N-(2-fluorophenyl)-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124765839 |
| Molecular Formula | C26H26FN3O5 |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (1S,2R,5R,6S,7R)-2-N-benzyl-6-N-(2-fluorophenyl)-3-(2-methoxyethyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COCCN1C(=O)[C@@H]2[C@H](C(=O)Nc3ccccc3F)[C@H]3C=C[C@@]2(O3)[C@@H]1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C26H26FN3O5/c1-34-14-13-30-22(24(32)28-15-16-7-3-2-4-8-16)26-12-11-19(35-26)20(21(26)25(30)33)23(31)29-18-10-6-5-9-17(18)27/h2-12,19-22H,13-15H2,1H3,(H,28,32)(H,29,31)/t19-,20-,21+,22+,26+/m1/s1 |
| InChIKey | NCQXYHKCRDLWGY-VVDZRIMGSA-N |
| XLogP | 1.88 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|