C22H27N3O6 — CID 98113774
(1S,2S,5R,6S,7S)-3-(2-methoxyethyl)-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98113774) has the molecular formula C22H27N3O6 and a molecular weight of 429.47 g/mol. Its IUPAC name is (1S,2S,5R,6S,7S)-3-(2-methoxyethyl)-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6S,7S)-3-(2-methoxyethyl)-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98113774 |
| Molecular Formula | C22H27N3O6 |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (1S,2S,5R,6S,7S)-3-(2-methoxyethyl)-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@@H]1[C@@H]2C=C[C@]3(O2)[C@@H]1C(=O)N(CCOC)[C@@H]3C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H27N3O6/c1-23-19(26)16-15-8-9-22(31-15)17(16)21(28)25(10-11-29-2)18(22)20(27)24-12-13-4-6-14(30-3)7-5-13/h4-9,15-18H,10-12H2,1-3H3,(H,23,26)(H,24,27)/t15-,16+,17-,18+,22-/m0/s1 |
| InChIKey | LSXMDXZPTBNLBQ-CDNTWCJUSA-N |
| XLogP | -0.15 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|