C22H25N3O5 — CID 99719352
(1R,2S,5R,6S,7R)-3-cyclopropyl-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99719352) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R)-3-cyclopropyl-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7R)-3-cyclopropyl-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99719352 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (1R,2S,5R,6S,7R)-3-cyclopropyl-2-N-[(4-methoxyphenyl)methyl]-6-N-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CNC(=O)[C@H]1[C@H]2C(=O)N(C3CC3)[C@H](C(=O)NCc3ccc(OC)cc3)[C@@]23C=C[C@H]1O3 |
| InChI | InChI=1S/C22H25N3O5/c1-23-19(26)16-15-9-10-22(30-15)17(16)21(28)25(13-5-6-13)18(22)20(27)24-11-12-3-7-14(29-2)8-4-12/h3-4,7-10,13,15-18H,5-6,11H2,1-2H3,(H,23,26)(H,24,27)/t15-,16-,17+,18-,22-/m1/s1 |
| InChIKey | WCABQFWWLJVNMK-GKICUZSHSA-N |
| XLogP | 0.37 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|