C33H39N3O4 — CID 124765973
(1S,2R,5S,6R,7R)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124765973) has the molecular formula C33H39N3O4 and a molecular weight of 541.69 g/mol. Its IUPAC name is (1S,2R,5S,6R,7R)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6R,7R)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124765973 |
| Molecular Formula | C33H39N3O4 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | (1S,2R,5S,6R,7R)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-7-methyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1N(c2ccc(C3CCCCC3)cc2)C(=O)[C@H]2[C@@H](C(=O)Nc3ccccc3)[C@@]3(C)C=C[C@@]12O3 |
| InChI | InChI=1S/C33H39N3O4/c1-31(2,3)35-29(38)27-33-20-19-32(4,40-33)25(28(37)34-23-13-9-6-10-14-23)26(33)30(39)36(27)24-17-15-22(16-18-24)21-11-7-5-8-12-21/h6,9-10,13-21,25-27H,5,7-8,11-12H2,1-4H3,(H,34,37)(H,35,38)/t25-,26+,27-,32+,33-/m0/s1 |
| InChIKey | PQKDINRDDPRYSF-VPJBZENJSA-N |
| XLogP | 5.33 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|