C35H43N3O5 — CID 98111149
(1R,2S,5R,6S,7S)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98111149) has the molecular formula C35H43N3O5 and a molecular weight of 585.75 g/mol. Its IUPAC name is (1R,2S,5R,6S,7S)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7S)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98111149 |
| Molecular Formula | C35H43N3O5 |
| Molecular Weight | 585.75 g/mol |
| Exact Mass | 585.32 |
| IUPAC Name | (1R,2S,5R,6S,7S)-2-N-tert-butyl-3-(4-cyclohexylphenyl)-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)[C@H]2[C@H]3C(=O)N(c4ccc(C5CCCCC5)cc4)[C@H](C(=O)NC(C)(C)C)[C@@]34C=C[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C35H43N3O5/c1-33(2,3)37-31(40)29-35-20-19-34(4,43-35)27(30(39)36-21-22-11-17-26(42-5)18-12-22)28(35)32(41)38(29)25-15-13-24(14-16-25)23-9-7-6-8-10-23/h11-20,23,27-29H,6-10,21H2,1-5H3,(H,36,39)(H,37,40)/t27-,28+,29-,34+,35-/m1/s1 |
| InChIKey | BLOGBZGRJNUCIB-RFGOOSCTSA-N |
| XLogP | 5.02 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.75 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|