C34H41N3O6 — CID 98111158
(1R,2S,5R,6S,7S)-2-N-cyclohexyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98111158) has the molecular formula C34H41N3O6 and a molecular weight of 587.72 g/mol. Its IUPAC name is (1R,2S,5R,6S,7S)-2-N-cyclohexyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7S)-2-N-cyclohexyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98111158 |
| Molecular Formula | C34H41N3O6 |
| Molecular Weight | 587.72 g/mol |
| Exact Mass | 587.30 |
| IUPAC Name | (1R,2S,5R,6S,7S)-2-N-cyclohexyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(CCN2C(=O)[C@@H]3[C@H](C(=O)NCc4ccc(OC)cc4)[C@]4(C)C=C[C@]3(O4)[C@H]2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C34H41N3O6/c1-33-18-19-34(43-33)28(27(33)30(38)35-21-23-11-15-26(42-3)16-12-23)32(40)37(20-17-22-9-13-25(41-2)14-10-22)29(34)31(39)36-24-7-5-4-6-8-24/h9-16,18-19,24,27-29H,4-8,17,20-21H2,1-3H3,(H,35,38)(H,36,39)/t27-,28+,29-,33+,34-/m1/s1 |
| InChIKey | YKFDGNKSRMIKDO-XYHMQKDISA-N |
| XLogP | 3.55 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.72 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|