C35H37N3O6 — CID 100827621
(1S,2R,5R,6R,7R)-2-N-benzyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 100827621) has the molecular formula C35H37N3O6 and a molecular weight of 595.70 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R)-2-N-benzyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7R)-2-N-benzyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 100827621 |
| Molecular Formula | C35H37N3O6 |
| Molecular Weight | 595.70 g/mol |
| Exact Mass | 595.27 |
| IUPAC Name | (1S,2R,5R,6R,7R)-2-N-benzyl-3-[2-(4-methoxyphenyl)ethyl]-6-N-[(4-methoxyphenyl)methyl]-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1ccc(CCN2C(=O)[C@@H]3[C@@H](C(=O)NCc4ccc(OC)cc4)[C@@]4(C)C=C[C@@]3(O4)[C@@H]2C(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C35H37N3O6/c1-34-18-19-35(44-34)29(28(34)31(39)36-22-25-11-15-27(43-3)16-12-25)33(41)38(20-17-23-9-13-26(42-2)14-10-23)30(35)32(40)37-21-24-7-5-4-6-8-24/h4-16,18-19,28-30H,17,20-22H2,1-3H3,(H,36,39)(H,37,40)/t28-,29-,30-,34+,35-/m0/s1 |
| InChIKey | LALNUKIZDNBZFX-HEIHHBAOSA-N |
| XLogP | 3.42 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.70 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|