C30H28ClN3O4S — CID 98111080
(1R,2S,5R,6S,7R)-2-N-benzyl-3-[(4-chlorophenyl)methyl]-7-methyl-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98111080) has the molecular formula C30H28ClN3O4S and a molecular weight of 562.09 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R)-2-N-benzyl-3-[(4-chlorophenyl)methyl]-7-methyl-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7R)-2-N-benzyl-3-[(4-chlorophenyl)methyl]-7-methyl-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98111080 |
| Molecular Formula | C30H28ClN3O4S |
| Molecular Weight | 562.09 g/mol |
| Exact Mass | 561.15 |
| IUPAC Name | (1R,2S,5R,6S,7R)-2-N-benzyl-3-[(4-chlorophenyl)methyl]-7-methyl-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@]12C=C[C@@]3(O1)[C@H](C(=O)N(Cc1ccc(Cl)cc1)[C@@H]3C(=O)NCc1ccccc1)[C@@H]2C(=O)NCc1cccs1 |
| InChI | InChI=1S/C30H28ClN3O4S/c1-29-13-14-30(38-29)24(23(29)26(35)33-17-22-8-5-15-39-22)28(37)34(18-20-9-11-21(31)12-10-20)25(30)27(36)32-16-19-6-3-2-4-7-19/h2-15,23-25H,16-18H2,1H3,(H,32,36)(H,33,35)/t23-,24+,25-,29-,30-/m1/s1 |
| InChIKey | IDYOZKRUOUWQBH-MGSDLZLPSA-N |
| XLogP | 4.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.09 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|