C27H37N3O4S — CID 100911455
(1S,2R,5R,6R,7R)-2-N-cyclohexyl-7-methyl-3-(3-methylbutyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 100911455) has the molecular formula C27H37N3O4S and a molecular weight of 499.68 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R)-2-N-cyclohexyl-7-methyl-3-(3-methylbutyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7R)-2-N-cyclohexyl-7-methyl-3-(3-methylbutyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 100911455 |
| Molecular Formula | C27H37N3O4S |
| Molecular Weight | 499.68 g/mol |
| Exact Mass | 499.25 |
| IUPAC Name | (1S,2R,5R,6R,7R)-2-N-cyclohexyl-7-methyl-3-(3-methylbutyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC(C)CCN1C(=O)[C@@H]2[C@@H](C(=O)NCc3cccs3)[C@@]3(C)C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C27H37N3O4S/c1-17(2)11-14-30-22(24(32)29-18-8-5-4-6-9-18)27-13-12-26(3,34-27)20(21(27)25(30)33)23(31)28-16-19-10-7-15-35-19/h7,10,12-13,15,17-18,20-22H,4-6,8-9,11,14,16H2,1-3H3,(H,28,31)(H,29,32)/t20-,21-,22-,26+,27-/m0/s1 |
| InChIKey | VPXKMPZXTNBIBY-GZFILCKSSA-N |
| XLogP | 3.40 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|