C30H38ClN3O4 — CID 98110865
(1R,2S,5R,6S,7S)-3-[(4-chlorophenyl)methyl]-2-N,6-N-dicyclohexyl-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98110865) has the molecular formula C30H38ClN3O4 and a molecular weight of 540.10 g/mol. Its IUPAC name is (1R,2S,5R,6S,7S)-3-[(4-chlorophenyl)methyl]-2-N,6-N-dicyclohexyl-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,2S,5R,6S,7S)-3-[(4-chlorophenyl)methyl]-2-N,6-N-dicyclohexyl-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98110865 |
| Molecular Formula | C30H38ClN3O4 |
| Molecular Weight | 540.10 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | (1R,2S,5R,6S,7S)-3-[(4-chlorophenyl)methyl]-2-N,6-N-dicyclohexyl-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@@]12C=C[C@@]3(O1)[C@H](C(=O)N(Cc1ccc(Cl)cc1)[C@@H]3C(=O)NC1CCCCC1)[C@@H]2C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H38ClN3O4/c1-29-16-17-30(38-29)24(23(29)26(35)32-21-8-4-2-5-9-21)28(37)34(18-19-12-14-20(31)15-13-19)25(30)27(36)33-22-10-6-3-7-11-22/h12-17,21-25H,2-11,18H2,1H3,(H,32,35)(H,33,36)/t23-,24+,25-,29+,30-/m1/s1 |
| InChIKey | WKWVIVIAKDXVLF-UYVMBCPWSA-N |
| XLogP | 4.28 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.10 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|