C30H30Cl3N3O4 — CID 87050023
(5R,7S)-3-[(4-chlorophenyl)methyl]-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87050023) has the molecular formula C30H30Cl3N3O4 and a molecular weight of 602.95 g/mol. Its IUPAC name is (5R,7S)-3-[(4-chlorophenyl)methyl]-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-3-[(4-chlorophenyl)methyl]-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87050023 |
| Molecular Formula | C30H30Cl3N3O4 |
| Molecular Weight | 602.95 g/mol |
| Exact Mass | 601.13 |
| IUPAC Name | (5R,7S)-3-[(4-chlorophenyl)methyl]-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@@]12C=CC3(O1)C(C(=O)NC1CCCCC1)N(Cc1ccc(Cl)cc1)C(=O)[C@@H]3C2C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C30H30Cl3N3O4/c1-29-13-14-30(40-29)24(23(29)26(37)35-20-11-12-21(32)22(33)15-20)28(39)36(16-17-7-9-18(31)10-8-17)25(30)27(38)34-19-5-3-2-4-6-19/h7-15,19,23-25H,2-6,16H2,1H3,(H,34,38)(H,35,37)/t23?,24-,25?,29-,30?/m0/s1 |
| InChIKey | WRBNAUMZBJSKMC-AMACTKAFSA-N |
| XLogP | 5.78 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.95 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|