C31H33Cl2N3O4 — CID 98363849
(1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[(1R)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98363849) has the molecular formula C31H33Cl2N3O4 and a molecular weight of 582.53 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[(1R)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[(1R)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98363849 |
| Molecular Formula | C31H33Cl2N3O4 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[(1R)-1-phenylethyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@H](c1ccccc1)N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccc(Cl)c(Cl)c3)[C@]3(C)C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C31H33Cl2N3O4/c1-18(19-9-5-3-6-10-19)36-26(28(38)34-20-11-7-4-8-12-20)31-16-15-30(2,40-31)24(25(31)29(36)39)27(37)35-21-13-14-22(32)23(33)17-21/h3,5-6,9-10,13-18,20,24-26H,4,7-8,11-12H2,1-2H3,(H,34,38)(H,35,37)/t18-,24+,25+,26+,30+,31+/m1/s1 |
| InChIKey | JYXYZSSHFLHZMH-JGJXOQRESA-N |
| XLogP | 5.68 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|