C28H33Cl2N3O5 — CID 129435880
(1S,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 129435880) has the molecular formula C28H33Cl2N3O5 and a molecular weight of 562.49 g/mol. Its IUPAC name is (1S,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 129435880 |
| Molecular Formula | C28H33Cl2N3O5 |
| Molecular Weight | 562.49 g/mol |
| Exact Mass | 561.18 |
| IUPAC Name | (1S,2R,5S,6S,7R)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-4-oxo-3-[[(2R)-oxolan-2-yl]methyl]-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@]12C=C[C@@]3(O1)[C@H](C(=O)NC1CCCCC1)N(C[C@H]1CCCO1)C(=O)[C@H]3[C@@H]2C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C28H33Cl2N3O5/c1-27-11-12-28(38-27)22(21(27)24(34)32-17-9-10-19(29)20(30)14-17)26(36)33(15-18-8-5-13-37-18)23(28)25(35)31-16-6-3-2-4-7-16/h9-12,14,16,18,21-23H,2-8,13,15H2,1H3,(H,31,35)(H,32,34)/t18-,21-,22-,23+,27-,28+/m1/s1 |
| InChIKey | JRAUWSYWDZWVGM-YWRCWVBRSA-N |
| XLogP | 4.10 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|