C30H37Cl2N3O4 — CID 98363824
(1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98363824) has the molecular formula C30H37Cl2N3O4 and a molecular weight of 574.55 g/mol. Its IUPAC name is (1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98363824 |
| Molecular Formula | C30H37Cl2N3O4 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 573.22 |
| IUPAC Name | (1S,2S,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[(1S,2R)-2-methylcyclohexyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@@H]1CCCC[C@@H]1N1C(=O)[C@@H]2[C@@H](C(=O)Nc3ccc(Cl)c(Cl)c3)[C@]3(C)C=C[C@@]2(O3)[C@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C30H37Cl2N3O4/c1-17-8-6-7-11-22(17)35-25(27(37)33-18-9-4-3-5-10-18)30-15-14-29(2,39-30)23(24(30)28(35)38)26(36)34-19-12-13-20(31)21(32)16-19/h12-18,22-25H,3-11H2,1-2H3,(H,33,37)(H,34,36)/t17-,22+,23+,24+,25-,29+,30+/m1/s1 |
| InChIKey | HGCFUKDGFAGUPA-YXZXTQLASA-N |
| XLogP | 5.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|