C32H35Cl2N3O4 — CID 98363797
(1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[2-(4-methylphenyl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98363797) has the molecular formula C32H35Cl2N3O4 and a molecular weight of 596.56 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[2-(4-methylphenyl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[2-(4-methylphenyl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98363797 |
| Molecular Formula | C32H35Cl2N3O4 |
| Molecular Weight | 596.56 g/mol |
| Exact Mass | 595.20 |
| IUPAC Name | (1S,2R,5R,6R,7S)-2-N-cyclohexyl-6-N-(3,4-dichlorophenyl)-7-methyl-3-[2-(4-methylphenyl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(CCN2C(=O)[C@@H]3[C@@H](C(=O)Nc4ccc(Cl)c(Cl)c4)[C@]4(C)C=C[C@@]3(O4)[C@@H]2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C32H35Cl2N3O4/c1-19-8-10-20(11-9-19)14-17-37-27(29(39)35-21-6-4-3-5-7-21)32-16-15-31(2,41-32)25(26(32)30(37)40)28(38)36-22-12-13-23(33)24(34)18-22/h8-13,15-16,18,21,25-27H,3-7,14,17H2,1-2H3,(H,35,39)(H,36,38)/t25-,26-,27-,31-,32-/m0/s1 |
| InChIKey | UKCDVCKVHRPGLI-PONGSQKHSA-N |
| XLogP | 5.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|