C26H32FN3O5 — CID 98111047
(1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-fluorophenyl)-3-(2-methoxyethyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 98111047) has the molecular formula C26H32FN3O5 and a molecular weight of 485.56 g/mol. Its IUPAC name is (1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-fluorophenyl)-3-(2-methoxyethyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-fluorophenyl)-3-(2-methoxyethyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 98111047 |
| Molecular Formula | C26H32FN3O5 |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.23 |
| IUPAC Name | (1S,2S,5R,6S,7S)-2-N-cyclohexyl-6-N-(4-fluorophenyl)-3-(2-methoxyethyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COCCN1C(=O)[C@@H]2[C@H](C(=O)Nc3ccc(F)cc3)[C@]3(C)C=C[C@@]2(O3)[C@H]1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C26H32FN3O5/c1-25-12-13-26(35-25)20(19(25)22(31)28-18-10-8-16(27)9-11-18)24(33)30(14-15-34-2)21(26)23(32)29-17-6-4-3-5-7-17/h8-13,17,19-21H,3-7,14-15H2,1-2H3,(H,28,31)(H,29,32)/t19-,20+,21-,25+,26+/m1/s1 |
| InChIKey | JXUALDMYKAGFGU-FGOOLWONSA-N |
| XLogP | 2.40 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|