C31H38FN3O4 — CID 99748106
(1S,2R,5R,6R,7S)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-fluorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 99748106) has the molecular formula C31H38FN3O4 and a molecular weight of 535.66 g/mol. Its IUPAC name is (1S,2R,5R,6R,7S)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-fluorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7S)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-fluorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 99748106 |
| Molecular Formula | C31H38FN3O4 |
| Molecular Weight | 535.66 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | (1S,2R,5R,6R,7S)-3-[2-(cyclohexen-1-yl)ethyl]-2-N-cyclohexyl-6-N-(4-fluorophenyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | C[C@@]12C=C[C@]3(O1)[C@H](C(=O)N(CCC1=CCCCC1)[C@H]3C(=O)NC1CCCCC1)[C@H]2C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C31H38FN3O4/c1-30-17-18-31(39-30)25(24(30)27(36)33-23-14-12-21(32)13-15-23)29(38)35(19-16-20-8-4-2-5-9-20)26(31)28(37)34-22-10-6-3-7-11-22/h8,12-15,17-18,22,24-26H,2-7,9-11,16,19H2,1H3,(H,33,36)(H,34,37)/t24-,25-,26-,30-,31-/m0/s1 |
| InChIKey | KCEODKTXJVRTDR-ZUOFVQRFSA-N |
| XLogP | 4.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.66 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|