C28H36FN3O4 — CID 100911495
(1S,2R,5R,6R,7R)-2-N-cyclopentyl-6-N-[(4-fluorophenyl)methyl]-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 100911495) has the molecular formula C28H36FN3O4 and a molecular weight of 497.61 g/mol. Its IUPAC name is (1S,2R,5R,6R,7R)-2-N-cyclopentyl-6-N-[(4-fluorophenyl)methyl]-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2R,5R,6R,7R)-2-N-cyclopentyl-6-N-[(4-fluorophenyl)methyl]-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 100911495 |
| Molecular Formula | C28H36FN3O4 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.27 |
| IUPAC Name | (1S,2R,5R,6R,7R)-2-N-cyclopentyl-6-N-[(4-fluorophenyl)methyl]-7-methyl-3-(2-methylbutan-2-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CCC(C)(C)N1C(=O)[C@@H]2[C@@H](C(=O)NCc3ccc(F)cc3)[C@@]3(C)C=C[C@@]2(O3)[C@@H]1C(=O)NC1CCCC1 |
| InChI | InChI=1S/C28H36FN3O4/c1-5-26(2,3)32-22(24(34)31-19-8-6-7-9-19)28-15-14-27(4,36-28)20(21(28)25(32)35)23(33)30-16-17-10-12-18(29)13-11-17/h10-15,19-22H,5-9,16H2,1-4H3,(H,30,33)(H,31,34)/t20-,21-,22-,27+,28-/m0/s1 |
| InChIKey | LTICWNYPCZIWQP-QARNNDALSA-N |
| XLogP | 3.23 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|