C30H29N3O4S — CID 124766026
(1S,2S,5R,6S,7R)-2-N-benzyl-3-(2,4-dimethylphenyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 124766026) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is (1S,2S,5R,6S,7R)-2-N-benzyl-3-(2,4-dimethylphenyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1S,2S,5R,6S,7R)-2-N-benzyl-3-(2,4-dimethylphenyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 124766026 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (1S,2S,5R,6S,7R)-2-N-benzyl-3-(2,4-dimethylphenyl)-4-oxo-6-N-(thiophen-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@H](C(=O)NCc4cccs4)[C@H]4C=C[C@@]3(O4)[C@H]2C(=O)NCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C30H29N3O4S/c1-18-10-11-22(19(2)15-18)33-26(28(35)31-16-20-7-4-3-5-8-20)30-13-12-23(37-30)24(25(30)29(33)36)27(34)32-17-21-9-6-14-38-21/h3-15,23-26H,16-17H2,1-2H3,(H,31,35)(H,32,34)/t23-,24-,25+,26-,30+/m1/s1 |
| InChIKey | QRZADRCBMRTNFR-UKGKTARGSA-N |
| XLogP | 3.65 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|