C25H33N3O — CID 124766670
N-[(Z)-[(5R,8S,9R,10S,13S,14R)-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]amino]pyridine-4-carboxamide (PubChem CID 124766670) has the molecular formula C25H33N3O and a molecular weight of 391.56 g/mol. Its IUPAC name is N-[(Z)-[(5R,8S,9R,10S,13S,14R)-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(Z)-[(5R,8S,9R,10S,13S,14R)-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 124766670 |
| Molecular Formula | C25H33N3O |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | N-[(Z)-[(5R,8S,9R,10S,13S,14R)-10,13-dimethyl-1,4,5,6,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-17-ylidene]amino]pyridine-4-carboxamide |
| SMILES | C[C@]12CC=CC[C@H]1CC[C@H]1[C@H]2CC[C@]2(C)/C(=N\NC(=O)c3ccncc3)CC[C@H]12 |
| InChI | InChI=1S/C25H33N3O/c1-24-13-4-3-5-18(24)6-7-19-20-8-9-22(25(20,2)14-10-21(19)24)27-28-23(29)17-11-15-26-16-12-17/h3-4,11-12,15-16,18-21H,5-10,13-14H2,1-2H3,(H,28,29)/b27-22-/t18-,19+,20+,21+,24-,25-/m0/s1 |
| InChIKey | NJHIQSIODLRTDP-CTBKPMNBSA-N |
| XLogP | 5.38 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|