C27H36 — CID 124768795
(5R,8S,9R,10S,13S,14R)-10,13-dimethyl-17-(2-phenylethyl)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 124768795) has the molecular formula C27H36 and a molecular weight of 360.59 g/mol. Its IUPAC name is (5R,8S,9R,10S,13S,14R)-10,13-dimethyl-17-(2-phenylethyl)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (5R,8S,9R,10S,13S,14R)-10,13-dimethyl-17-(2-phenylethyl)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 124768795 |
| Molecular Formula | C27H36 |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | (5R,8S,9R,10S,13S,14R)-10,13-dimethyl-17-(2-phenylethyl)-4,5,6,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC=CC[C@H]1CC[C@H]1[C@H]2CC[C@]2(C)C(CCc3ccccc3)=CC[C@H]12 |
| InChI | InChI=1S/C27H36/c1-26-18-7-6-10-21(26)13-15-23-24-16-14-22(27(24,2)19-17-25(23)26)12-11-20-8-4-3-5-9-20/h3-9,14,21,23-25H,10-13,15-19H2,1-2H3/t21-,23+,24+,25+,26-,27+/m0/s1 |
| InChIKey | VBTNPIPMZUSOJR-RKSFPMLDSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|