C26H36O — CID 11868900
(5S,8S,9R,10S,13S,14S,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 11868900) has the molecular formula C26H36O and a molecular weight of 364.57 g/mol. Its IUPAC name is (5S,8S,9R,10S,13S,14S,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (5S,8S,9R,10S,13S,14S,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 11868900 |
| Molecular Formula | C26H36O |
| Molecular Weight | 364.57 g/mol |
| Exact Mass | 364.28 |
| IUPAC Name | (5S,8S,9R,10S,13S,14S,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@]12CC=CC[C@@H]1CC[C@H]1[C@H]2CC[C@]2(C)[C@@H](OCc3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C26H36O/c1-25-16-7-6-10-20(25)11-12-21-22-13-14-24(26(22,2)17-15-23(21)25)27-18-19-8-4-3-5-9-19/h3-9,20-24H,10-18H2,1-2H3/t20-,21-,22+,23-,24+,25+,26+/m1/s1 |
| InChIKey | ZSXQKJCUWHUJJR-KSPBMBKWSA-N |
| XLogP | 6.78 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|