C32H46O3 — CID 162913511
ethyl 2-[(5S,8R,9S,10R,13R,14R,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropanoate (PubChem CID 162913511) has the molecular formula C32H46O3 and a molecular weight of 478.72 g/mol. Its IUPAC name is ethyl 2-[(5S,8R,9S,10R,13R,14R,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[(5S,8R,9S,10R,13R,14R,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 162913511 |
| Molecular Formula | C32H46O3 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 478.34 |
| IUPAC Name | ethyl 2-[(5S,8R,9S,10R,13R,14R,17S)-10,13-dimethyl-17-phenylmethoxy-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)C1=CC[C@]2(C)[C@@H](CC[C@H]3[C@H]4CC[C@H](OCc5ccccc5)[C@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C32H46O3/c1-6-34-29(33)30(2,3)23-16-18-31(4)24(20-23)12-13-25-26-14-15-28(32(26,5)19-17-27(25)31)35-21-22-10-8-7-9-11-22/h7-11,16,24-28H,6,12-15,17-21H2,1-5H3/t24-,25-,26+,27-,28-,31+,32+/m0/s1 |
| InChIKey | IBVFQPADUBNBIW-ISMZGUDNSA-N |
| XLogP | 7.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|