C27H40O2 — CID 70072648
[(3S,5R,8R,9S,10S,13S,14S,17S)-3-benzyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxymethanol (PubChem CID 70072648) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is [(3S,5R,8R,9S,10S,13S,14S,17S)-3-benzyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxymethanol.
| Compound Name | [(3S,5R,8R,9S,10S,13S,14S,17S)-3-benzyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxymethanol |
|---|---|
| PubChem CID | 70072648 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | [(3S,5R,8R,9S,10S,13S,14S,17S)-3-benzyl-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]oxymethanol |
| SMILES | C[C@]12CC[C@H](Cc3ccccc3)C[C@H]1CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OCO)CC[C@@H]12 |
| InChI | InChI=1S/C27H40O2/c1-26-14-12-20(16-19-6-4-3-5-7-19)17-21(26)8-9-22-23-10-11-25(29-18-28)27(23,2)15-13-24(22)26/h3-7,20-25,28H,8-18H2,1-2H3/t20-,21-,22+,23+,24+,25+,26+,27+/m1/s1 |
| InChIKey | PRHNPQFNAPSURD-LADYEXLUSA-N |
| XLogP | 6.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|