C31H47NO2 — CID 145442928
N-benzyl-3-(ethoxymethyl)-N,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide (PubChem CID 145442928) has the molecular formula C31H47NO2 and a molecular weight of 465.72 g/mol. Its IUPAC name is N-benzyl-3-(ethoxymethyl)-N,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide.
| Compound Name | N-benzyl-3-(ethoxymethyl)-N,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
|---|---|
| PubChem CID | 145442928 |
| Molecular Formula | C31H47NO2 |
| Molecular Weight | 465.72 g/mol |
| Exact Mass | 465.36 |
| IUPAC Name | N-benzyl-3-(ethoxymethyl)-N,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthrene-17-carboxamide |
| SMILES | CCOCC1CCC2(C)C(CCC3C2CCC2(C)C(C(=O)N(C)Cc4ccccc4)CCC32)C1 |
| InChI | InChI=1S/C31H47NO2/c1-5-34-21-23-15-17-30(2)24(19-23)11-12-25-26-13-14-28(31(26,3)18-16-27(25)30)29(33)32(4)20-22-9-7-6-8-10-22/h6-10,23-28H,5,11-21H2,1-4H3 |
| InChIKey | XMWOKBVZMVUJPU-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |