C28H37NO4 — CID 15485982
[(8R,9S,10S,13S,14S,17S)-3-(methoxycarbamoyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 15485982) has the molecular formula C28H37NO4 and a molecular weight of 451.61 g/mol. Its IUPAC name is [(8R,9S,10S,13S,14S,17S)-3-(methoxycarbamoyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8R,9S,10S,13S,14S,17S)-3-(methoxycarbamoyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 15485982 |
| Molecular Formula | C28H37NO4 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | [(8R,9S,10S,13S,14S,17S)-3-(methoxycarbamoyl)-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CONC(=O)C1=CC[C@@]2(C)C(CC[C@H]3[C@@H]4CC[C@H](OC(=O)c5ccccc5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H37NO4/c1-27-15-13-19(25(30)29-32-3)17-20(27)9-10-21-22-11-12-24(28(22,2)16-14-23(21)27)33-26(31)18-7-5-4-6-8-18/h4-8,13,20-24H,9-12,14-17H2,1-3H3,(H,29,30)/t20?,21-,22-,23-,24-,27-,28-/m0/s1 |
| InChIKey | VEXXBGZMWGTADL-QXTJJCJHSA-N |
| XLogP | 5.47 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|