C36H43N3O3 — CID 6186276
[(3Z)-3-[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 6186276) has the molecular formula C36H43N3O3 and a molecular weight of 565.76 g/mol. Its IUPAC name is [(3Z)-3-[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(3Z)-3-[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 6186276 |
| Molecular Formula | C36H43N3O3 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | [(3Z)-3-[[2-(1H-indol-3-yl)acetyl]hydrazinylidene]-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC12CC/C(=N/NC(=O)Cc3c[nH]c4ccccc34)CC1CCC1C2CCC2(C)C(OC(=O)c3ccccc3)CCC12 |
| InChI | InChI=1S/C36H43N3O3/c1-35-18-16-26(38-39-33(40)20-24-22-37-31-11-7-6-10-27(24)31)21-25(35)12-13-28-29-14-15-32(36(29,2)19-17-30(28)35)42-34(41)23-8-4-3-5-9-23/h3-11,22,25,28-30,32,37H,12-21H2,1-2H3,(H,39,40)/b38-26- |
| InChIKey | PTFGKGBXJGIRDA-HBAMXUDRSA-N |
| XLogP | 7.45 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|