C26H30Cl2O2 — CID 124769496
(3S,8S,9R,10R,13S,14R,16E)-16-[(2,3-dichlorophenyl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 124769496) has the molecular formula C26H30Cl2O2 and a molecular weight of 445.43 g/mol. Its IUPAC name is (3S,8S,9R,10R,13S,14R,16E)-16-[(2,3-dichlorophenyl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8S,9R,10R,13S,14R,16E)-16-[(2,3-dichlorophenyl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 124769496 |
| Molecular Formula | C26H30Cl2O2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | (3S,8S,9R,10R,13S,14R,16E)-16-[(2,3-dichlorophenyl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H](O)CC1=CC[C@H]1[C@H]2CC[C@]2(C)C(=O)/C(=C/c3cccc(Cl)c3Cl)C[C@H]12 |
| InChI | InChI=1S/C26H30Cl2O2/c1-25-10-8-18(29)14-17(25)6-7-19-20(25)9-11-26(2)21(19)13-16(24(26)30)12-15-4-3-5-22(27)23(15)28/h3-6,12,18-21,29H,7-11,13-14H2,1-2H3/b16-12+/t18-,19-,20+,21+,25-,26-/m0/s1 |
| InChIKey | YGBQOUNQDOEMKJ-NDKAXUMMSA-N |
| XLogP | 6.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|