C30H34O2S — CID 124906888
(3S,8S,9R,10R,13R,14R,16E)-3-hydroxy-10,13-dimethyl-16-[(5-phenylthiophen-2-yl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 124906888) has the molecular formula C30H34O2S and a molecular weight of 458.67 g/mol. Its IUPAC name is (3S,8S,9R,10R,13R,14R,16E)-3-hydroxy-10,13-dimethyl-16-[(5-phenylthiophen-2-yl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3S,8S,9R,10R,13R,14R,16E)-3-hydroxy-10,13-dimethyl-16-[(5-phenylthiophen-2-yl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 124906888 |
| Molecular Formula | C30H34O2S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (3S,8S,9R,10R,13R,14R,16E)-3-hydroxy-10,13-dimethyl-16-[(5-phenylthiophen-2-yl)methylidene]-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@@]12CC[C@@H]3[C@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@H]1C/C(=C\c1ccc(-c3ccccc3)s1)C2=O |
| InChI | InChI=1S/C30H34O2S/c1-29-14-12-22(31)18-21(29)8-10-24-25(29)13-15-30(2)26(24)17-20(28(30)32)16-23-9-11-27(33-23)19-6-4-3-5-7-19/h3-9,11,16,22,24-26,31H,10,12-15,17-18H2,1-2H3/b20-16+/t22-,24-,25+,26+,29-,30+/m0/s1 |
| InChIKey | VGZYSFLMWKRVEA-WBMVLPGNSA-N |
| XLogP | 7.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|