C31H38N2O2 — CID 99572834
(3R,8R,9S,10R,13S,14S,16E)-16-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one (PubChem CID 99572834) has the molecular formula C31H38N2O2 and a molecular weight of 470.66 g/mol. Its IUPAC name is (3R,8R,9S,10R,13S,14S,16E)-16-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one.
| Compound Name | (3R,8R,9S,10R,13S,14S,16E)-16-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 99572834 |
| Molecular Formula | C31H38N2O2 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | (3R,8R,9S,10R,13S,14S,16E)-16-[(3,5-dimethyl-1-phenylpyrazol-4-yl)methylidene]-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-one |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1/C=C1\C[C@H]2[C@@H]3CC=C4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]2(C)C1=O |
| InChI | InChI=1S/C31H38N2O2/c1-19-26(20(2)33(32-19)23-8-6-5-7-9-23)16-21-17-28-25-11-10-22-18-24(34)12-14-30(22,3)27(25)13-15-31(28,4)29(21)35/h5-10,16,24-25,27-28,34H,11-15,17-18H2,1-4H3/b21-16+/t24-,25-,27+,28+,30+,31+/m1/s1 |
| InChIKey | QCXNNNINRUAKEF-PEKKHVCLSA-N |
| XLogP | 6.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|