C25H23F5N2O — CID 124770736
(8S,9S,13S,14R,17Z)-13-methyl-17-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 124770736) has the molecular formula C25H23F5N2O and a molecular weight of 462.46 g/mol. Its IUPAC name is (8S,9S,13S,14R,17Z)-13-methyl-17-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8S,9S,13S,14R,17Z)-13-methyl-17-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 124770736 |
| Molecular Formula | C25H23F5N2O |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | (8S,9S,13S,14R,17Z)-13-methyl-17-[(Z)-(2,3,4,5,6-pentafluorophenyl)methylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@@H]3[C@H]1CC/C2=N/N=C\c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C25H23F5N2O/c1-25-9-8-15-14-5-3-13(33)10-12(14)2-4-16(15)18(25)6-7-19(25)32-31-11-17-20(26)22(28)24(30)23(29)21(17)27/h3,5,10-11,15-16,18,33H,2,4,6-9H2,1H3/b31-11-,32-19-/t15-,16+,18-,25+/m1/s1 |
| InChIKey | MZASFPZPUCODOP-NGIFOMBPSA-N |
| XLogP | 6.42 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|