C29H30N2O — CID 177401420
(8R,9S,13S,14S,17E)-13-methyl-17-[(E)-naphthalen-2-ylmethylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol (PubChem CID 177401420) has the molecular formula C29H30N2O and a molecular weight of 422.57 g/mol. Its IUPAC name is (8R,9S,13S,14S,17E)-13-methyl-17-[(E)-naphthalen-2-ylmethylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (8R,9S,13S,14S,17E)-13-methyl-17-[(E)-naphthalen-2-ylmethylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 177401420 |
| Molecular Formula | C29H30N2O |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | (8R,9S,13S,14S,17E)-13-methyl-17-[(E)-naphthalen-2-ylmethylidenehydrazinylidene]-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4CC[C@H]3[C@@H]1CC/C2=N\N=C\c1ccc2ccccc2c1 |
| InChI | InChI=1S/C29H30N2O/c1-29-15-14-25-24-11-9-23(32)17-22(24)8-10-26(25)27(29)12-13-28(29)31-30-18-19-6-7-20-4-2-3-5-21(20)16-19/h2-7,9,11,16-18,25-27,32H,8,10,12-15H2,1H3/b30-18+,31-28+/t25-,26-,27+,29+/m1/s1 |
| InChIKey | IERIUAVXVSWJOK-IIFZRXTRSA-N |
| XLogP | 6.88 |
| TPSA | 44.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|