C23H28FN3O3 — CID 124771060
(1'S,11'R,12'S)-4'-fluoro-1,3,12',14',14'-pentamethylspiro[1,3-diazinane-5,10'-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene]-2,4,6-trione (PubChem CID 124771060) has the molecular formula C23H28FN3O3 and a molecular weight of 413.49 g/mol. Its IUPAC name is (1'S,11'R,12'S)-4'-fluoro-1,3,12',14',14'-pentamethylspiro[1,3-diazinane-5,10'-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene]-2,4,6-trione.
| Compound Name | (1'S,11'R,12'S)-4'-fluoro-1,3,12',14',14'-pentamethylspiro[1,3-diazinane-5,10'-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene]-2,4,6-trione |
|---|---|
| PubChem CID | 124771060 |
| Molecular Formula | C23H28FN3O3 |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | (1'S,11'R,12'S)-4'-fluoro-1,3,12',14',14'-pentamethylspiro[1,3-diazinane-5,10'-2-azatetracyclo[10.3.1.02,11.03,8]hexadeca-3(8),4,6-triene]-2,4,6-trione |
| SMILES | CN1C(=O)N(C)C(=O)C2(Cc3cccc(F)c3N3[C@H]4CC(C)(C)C[C@@](C)(C4)[C@@H]32)C1=O |
| InChI | InChI=1S/C23H28FN3O3/c1-21(2)10-14-11-22(3,12-21)17-23(18(28)25(4)20(30)26(5)19(23)29)9-13-7-6-8-15(24)16(13)27(14)17/h6-8,14,17H,9-12H2,1-5H3/t14-,17+,22+/m0/s1 |
| InChIKey | DQPHCGCUOUCMGY-WTBBCNCBSA-N |
| XLogP | 3.19 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|