C15H14FNO3 — CID 7679309
(3aR,4S)-9-fluorospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-oxolane]-2',4'-dione (PubChem CID 7679309) has the molecular formula C15H14FNO3 and a molecular weight of 275.28 g/mol. Its IUPAC name is (3aR,4S)-9-fluorospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-oxolane]-2',4'-dione.
| Compound Name | (3aR,4S)-9-fluorospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-oxolane]-2',4'-dione |
|---|---|
| PubChem CID | 7679309 |
| Molecular Formula | C15H14FNO3 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | (3aR,4S)-9-fluorospiro[2,3,3a,5-tetrahydro-1H-pyrrolo[1,2-a]quinoline-4,3'-oxolane]-2',4'-dione |
| SMILES | O=C1COC(=O)[C@]12Cc1cccc(F)c1N1CCC[C@@H]12 |
| InChI | InChI=1S/C15H14FNO3/c16-10-4-1-3-9-7-15(12(18)8-20-14(15)19)11-5-2-6-17(11)13(9)10/h1,3-4,11H,2,5-8H2/t11-,15+/m1/s1 |
| InChIKey | XISBXZCNBXWLMM-ABAIWWIYSA-N |
| XLogP | 1.46 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|