C22H20FN3O5 — CID 17037274
10'-fluoro-1-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione (PubChem CID 17037274) has the molecular formula C22H20FN3O5 and a molecular weight of 425.42 g/mol. Its IUPAC name is 10'-fluoro-1-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione.
| Compound Name | 10'-fluoro-1-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
|---|---|
| PubChem CID | 17037274 |
| Molecular Formula | C22H20FN3O5 |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | 10'-fluoro-1-(4-methoxyphenyl)spiro[1,3-diazinane-5,5'-2,4,4a,6-tetrahydro-1H-[1,4]oxazino[4,3-a]quinoline]-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)NC(=O)C3(Cc4cccc(F)c4N4CCOCC43)C2=O)cc1 |
| InChI | InChI=1S/C22H20FN3O5/c1-30-15-7-5-14(6-8-15)26-20(28)22(19(27)24-21(26)29)11-13-3-2-4-16(23)18(13)25-9-10-31-12-17(22)25/h2-8,17H,9-12H2,1H3,(H,24,27,29) |
| InChIKey | NGBGJZGLWQIINZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|