C22H29NO9 — CID 124771290
[(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(3-ethylphenoxy)oxan-2-yl]methyl acetate (PubChem CID 124771290) has the molecular formula C22H29NO9 and a molecular weight of 451.47 g/mol. Its IUPAC name is [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(3-ethylphenoxy)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(3-ethylphenoxy)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124771290 |
| Molecular Formula | C22H29NO9 |
| Molecular Weight | 451.47 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | [(2R,3R,4S,5S,6S)-5-acetamido-3,4-diacetyloxy-6-(3-ethylphenoxy)oxan-2-yl]methyl acetate |
| SMILES | CCc1cccc(O[C@@H]2O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]2NC(C)=O)c1 |
| InChI | InChI=1S/C22H29NO9/c1-6-16-8-7-9-17(10-16)31-22-19(23-12(2)24)21(30-15(5)27)20(29-14(4)26)18(32-22)11-28-13(3)25/h7-10,18-22H,6,11H2,1-5H3,(H,23,24)/t18-,19+,20+,21+,22-/m1/s1 |
| InChIKey | KSHPBEISIUPROH-LLVBAIKDSA-N |
| XLogP | 1.28 |
| TPSA | 126.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.47 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|