C23H25NO7 — CID 124771294
N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]oxan-3-yl]acetamide (PubChem CID 124771294) has the molecular formula C23H25NO7 and a molecular weight of 427.45 g/mol. Its IUPAC name is N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]oxan-3-yl]acetamide.
| Compound Name | N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 124771294 |
| Molecular Formula | C23H25NO7 |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | N-[(2S,3S,4R,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-2-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]oxan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H](Oc2ccccc2/C=C/C(=O)c2ccccc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H25NO7/c1-14(26)24-20-22(29)21(28)19(13-25)31-23(20)30-18-10-6-5-9-16(18)11-12-17(27)15-7-3-2-4-8-15/h2-12,19-23,25,28-29H,13H2,1H3,(H,24,26)/b12-11+/t19-,20+,21-,22-,23-/m1/s1 |
| InChIKey | KUVKOKYHHVKVFE-DSYDYWTDSA-N |
| XLogP | 0.91 |
| TPSA | 125.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|