C30H29NO7 — CID 124833400
N-[(2S,4aR,6S,7S,8R,8aS)-8-hydroxy-6-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 124833400) has the molecular formula C30H29NO7 and a molecular weight of 515.56 g/mol. Its IUPAC name is N-[(2S,4aR,6S,7S,8R,8aS)-8-hydroxy-6-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(2S,4aR,6S,7S,8R,8aS)-8-hydroxy-6-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 124833400 |
| Molecular Formula | C30H29NO7 |
| Molecular Weight | 515.56 g/mol |
| Exact Mass | 515.19 |
| IUPAC Name | N-[(2S,4aR,6S,7S,8R,8aS)-8-hydroxy-6-[2-[(E)-3-oxo-3-phenylprop-1-enyl]phenoxy]-2-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H](Oc2ccccc2/C=C/C(=O)c2ccccc2)O[C@@H]2CO[C@H](c3ccccc3)O[C@H]2[C@@H]1O |
| InChI | InChI=1S/C30H29NO7/c1-19(32)31-26-27(34)28-25(18-35-29(38-28)22-13-6-3-7-14-22)37-30(26)36-24-15-9-8-12-21(24)16-17-23(33)20-10-4-2-5-11-20/h2-17,25-30,34H,18H2,1H3,(H,31,32)/b17-16+/t25-,26+,27-,28-,29+,30-/m1/s1 |
| InChIKey | LCMHOYGXUSEPPY-QHPVWNCMSA-N |
| XLogP | 3.67 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.56 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|