C22H30N4OS — CID 124772121
(2R)-N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 124772121) has the molecular formula C22H30N4OS and a molecular weight of 398.58 g/mol. Its IUPAC name is (2R)-N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 124772121 |
| Molecular Formula | C22H30N4OS |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | (2R)-N-[(1R)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]heptanyl]ethyl]-2-[[4-(2,4-dimethylphenyl)-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | Cc1ccc(-n2cnnc2S[C@H](C)C(=O)N[C@H](C)[C@H]2C[C@H]3CC[C@H]2C3)c(C)c1 |
| InChI | InChI=1S/C22H30N4OS/c1-13-5-8-20(14(2)9-13)26-12-23-25-22(26)28-16(4)21(27)24-15(3)19-11-17-6-7-18(19)10-17/h5,8-9,12,15-19H,6-7,10-11H2,1-4H3,(H,24,27)/t15-,16-,17+,18+,19-/m1/s1 |
| InChIKey | DIKFUFUVAVKQAA-ZSXDVEMLSA-N |
| XLogP | 4.31 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |